Structure Database (LMSD)


LMSD: Lipid classification search results

Prenol Lipids [PR] (W) --> Isoprenoids [PR01]--> C15 isoprenoids (sesquiterpenes) [PR0103]--> Longipinane sesquiterpenoids [PR010349]
LM_IDCommon NameSystematic NameSpecies ShorthandFormulaMass
LMPR0103490001(+)-α-Longipinene(+)-3-longipinene-C15H24204.1878
LMPR01034900028β-Hydroxy-3-longipinen-5-one--C15H22O2234.1620
LMPR0103490003(+)-Vulgraon B(+)-3-longipinen-5-one-C16H24216.1878